C14H14ClF2NO4 — CID 168876831
2-chloro-5,5-difluoro-4-(oxetan-3-yloxy)spiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 168876831) has the molecular formula C14H14ClF2NO4 and a molecular weight of 333.72 g/mol. Its IUPAC name is 2-chloro-5,5-difluoro-4-(oxetan-3-yloxy)spiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 2-chloro-5,5-difluoro-4-(oxetan-3-yloxy)spiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 168876831 |
| Molecular Formula | C14H14ClF2NO4 |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-chloro-5,5-difluoro-4-(oxetan-3-yloxy)spiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | FC1(F)COC2(CCOC2)c2nc(Cl)cc(OC3COC3)c21 |
| InChI | InChI=1S/C14H14ClF2NO4/c15-10-3-9(22-8-4-20-5-8)11-12(18-10)13(1-2-19-6-13)21-7-14(11,16)17/h3,8H,1-2,4-7H2 |
| InChIKey | LPCTYZFGJANABV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|