C16H18ClF2NO3 — CID 168876901
2-chloro-4-[(3,3-difluorocyclobutyl)methoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 168876901) has the molecular formula C16H18ClF2NO3 and a molecular weight of 345.77 g/mol. Its IUPAC name is 2-chloro-4-[(3,3-difluorocyclobutyl)methoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 2-chloro-4-[(3,3-difluorocyclobutyl)methoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 168876901 |
| Molecular Formula | C16H18ClF2NO3 |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-chloro-4-[(3,3-difluorocyclobutyl)methoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | FC1(F)CC(COc2cc(Cl)nc3c2CCOC32CCOC2)C1 |
| InChI | InChI=1S/C16H18ClF2NO3/c17-13-5-12(22-8-10-6-16(18,19)7-10)11-1-3-23-15(14(11)20-13)2-4-21-9-15/h5,10H,1-4,6-9H2 |
| InChIKey | VLWRPNKUKZRJTQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|