C12H12ClF2NO2 — CID 162728854
2-chloro-4-(difluoromethyl)spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 162728854) has the molecular formula C12H12ClF2NO2 and a molecular weight of 275.68 g/mol. Its IUPAC name is 2-chloro-4-(difluoromethyl)spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 2-chloro-4-(difluoromethyl)spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 162728854 |
| Molecular Formula | C12H12ClF2NO2 |
| Molecular Weight | 275.68 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-4-(difluoromethyl)spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | FC(F)c1cc(Cl)nc2c1CCOC21CCOC1 |
| InChI | InChI=1S/C12H12ClF2NO2/c13-9-5-8(11(14)15)7-1-3-18-12(10(7)16-9)2-4-17-6-12/h5,11H,1-4,6H2 |
| InChIKey | IFDZWFBUHUBXJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|