C15H18ClF2NO3 — CID 170351375
2-chloro-4-[3-(difluoromethyl)cyclobutyl]oxy-6-(3-methoxyoxolan-3-yl)pyridine (PubChem CID 170351375) has the molecular formula C15H18ClF2NO3 and a molecular weight of 333.76 g/mol. Its IUPAC name is 2-chloro-4-[3-(difluoromethyl)cyclobutyl]oxy-6-(3-methoxyoxolan-3-yl)pyridine.
| Compound Name | 2-chloro-4-[3-(difluoromethyl)cyclobutyl]oxy-6-(3-methoxyoxolan-3-yl)pyridine |
|---|---|
| PubChem CID | 170351375 |
| Molecular Formula | C15H18ClF2NO3 |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-4-[3-(difluoromethyl)cyclobutyl]oxy-6-(3-methoxyoxolan-3-yl)pyridine |
| SMILES | COC1(c2cc(OC3CC(C(F)F)C3)cc(Cl)n2)CCOC1 |
| InChI | InChI=1S/C15H18ClF2NO3/c1-20-15(2-3-21-8-15)12-6-11(7-13(16)19-12)22-10-4-9(5-10)14(17)18/h6-7,9-10,14H,2-5,8H2,1H3 |
| InChIKey | GMBXUZRTTBRGKF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|