C14H16ClF2NO3 — CID 170577605
2-chloro-4-(3,3-difluorocyclobutyl)oxy-6-(3-methoxyoxolan-3-yl)pyridine (PubChem CID 170577605) has the molecular formula C14H16ClF2NO3 and a molecular weight of 319.74 g/mol. Its IUPAC name is 2-chloro-4-(3,3-difluorocyclobutyl)oxy-6-(3-methoxyoxolan-3-yl)pyridine.
| Compound Name | 2-chloro-4-(3,3-difluorocyclobutyl)oxy-6-(3-methoxyoxolan-3-yl)pyridine |
|---|---|
| PubChem CID | 170577605 |
| Molecular Formula | C14H16ClF2NO3 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-chloro-4-(3,3-difluorocyclobutyl)oxy-6-(3-methoxyoxolan-3-yl)pyridine |
| SMILES | COC1(c2cc(OC3CC(F)(F)C3)cc(Cl)n2)CCOC1 |
| InChI | InChI=1S/C14H16ClF2NO3/c1-19-13(2-3-20-8-13)11-4-9(5-12(15)18-11)21-10-6-14(16,17)7-10/h4-5,10H,2-3,6-8H2,1H3 |
| InChIKey | ZMOYIKQOKCBFIA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|