C24H34F2N6O — CID 162729949
1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enyl]-5-propan-2-ylpyridin-2-one (PubChem CID 162729949) has the molecular formula C24H34F2N6O and a molecular weight of 460.57 g/mol. Its IUPAC name is 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enyl]-5-propan-2-ylpyridin-2-one.
| Compound Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enyl]-5-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 162729949 |
| Molecular Formula | C24H34F2N6O |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enyl]-5-propan-2-ylpyridin-2-one |
| SMILES | CCc1nc(/C(N)=C(\Cn2cc(C(C)C)ccc2=O)N(C)N)ccc1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C24H34F2N6O/c1-5-18-20(31-12-6-11-24(25,26)15-31)9-8-19(29-18)23(27)21(30(4)28)14-32-13-17(16(2)3)7-10-22(32)33/h7-10,13,16H,5-6,11-12,14-15,27-28H2,1-4H3/b23-21- |
| InChIKey | YSZHAOWOPTVQQS-LNVKXUELSA-N |
| XLogP | 3.30 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|