C25H35FN6O2 — CID 162730144
2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-(2-oxo-5-propyl-1-pyridinyl)prop-1-enyl]-4-fluoro-2-methyl-3-pyridinyl]piperidin-3-yl]acetaldehyde (PubChem CID 162730144) has the molecular formula C25H35FN6O2 and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-(2-oxo-5-propyl-1-pyridinyl)prop-1-enyl]-4-fluoro-2-methyl-3-pyridinyl]piperidin-3-yl]acetaldehyde.
| Compound Name | 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-(2-oxo-5-propyl-1-pyridinyl)prop-1-enyl]-4-fluoro-2-methyl-3-pyridinyl]piperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 162730144 |
| Molecular Formula | C25H35FN6O2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-(2-oxo-5-propyl-1-pyridinyl)prop-1-enyl]-4-fluoro-2-methyl-3-pyridinyl]piperidin-3-yl]acetaldehyde |
| SMILES | CCCc1ccc(=O)n(C/C(=C(/N)c2cc(F)c(N3CCCC(CC=O)C3)c(C)n2)N(C)N)c1 |
| InChI | InChI=1S/C25H35FN6O2/c1-4-6-18-8-9-23(34)32(15-18)16-22(30(3)28)24(27)21-13-20(26)25(17(2)29-21)31-11-5-7-19(14-31)10-12-33/h8-9,12-13,15,19H,4-7,10-11,14,16,27-28H2,1-3H3/b24-22- |
| InChIKey | VGBRWLFTMJLZRO-GYHWCHFESA-N |
| XLogP | 2.58 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|