C27H40N4 — CID 166804251
(Z)-2-[amino(methyl)amino]-1-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]-4-methyl-6-phenylhex-1-en-1-amine (PubChem CID 166804251) has the molecular formula C27H40N4 and a molecular weight of 420.65 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]-4-methyl-6-phenylhex-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]-4-methyl-6-phenylhex-1-en-1-amine |
|---|---|
| PubChem CID | 166804251 |
| Molecular Formula | C27H40N4 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]-4-methyl-6-phenylhex-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\CC(C)CCc2ccccc2)N(C)N)ccc1CC1CCCCC1 |
| InChI | InChI=1S/C27H40N4/c1-20(14-15-22-10-6-4-7-11-22)18-26(31(3)29)27(28)25-17-16-24(21(2)30-25)19-23-12-8-5-9-13-23/h4,6-7,10-11,16-17,20,23H,5,8-9,12-15,18-19,28-29H2,1-3H3/b27-26- |
| InChIKey | PECWJPBNQKSMAB-RQZHXJHFSA-N |
| XLogP | 5.60 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|