C26H37N5O2 — CID 154936308
[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-ethyl-2-pyridinyl]prop-2-enyl] N-benzylcarbamate (PubChem CID 154936308) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-ethyl-2-pyridinyl]prop-2-enyl] N-benzylcarbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-ethyl-2-pyridinyl]prop-2-enyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 154936308 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-ethyl-2-pyridinyl]prop-2-enyl] N-benzylcarbamate |
| SMILES | CCc1nc(/C(N)=C(\COC(=O)NCc2ccccc2)N(C)N)ccc1CC1CCCCC1 |
| InChI | InChI=1S/C26H37N5O2/c1-3-22-21(16-19-10-6-4-7-11-19)14-15-23(30-22)25(27)24(31(2)28)18-33-26(32)29-17-20-12-8-5-9-13-20/h5,8-9,12-15,19H,3-4,6-7,10-11,16-18,27-28H2,1-2H3,(H,29,32)/b25-24- |
| InChIKey | NHYVMLYNSQVFPD-IZHYLOQSSA-N |
| XLogP | 4.13 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|