C24H37F2N7O3 — CID 162730321
acetaldehyde;1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)pyrazin-2-yl]prop-2-enyl]-5-propylpyridin-2-one;methanol (PubChem CID 162730321) has the molecular formula C24H37F2N7O3 and a molecular weight of 509.60 g/mol. Its IUPAC name is acetaldehyde;1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)pyrazin-2-yl]prop-2-enyl]-5-propylpyridin-2-one;methanol.
| Compound Name | acetaldehyde;1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)pyrazin-2-yl]prop-2-enyl]-5-propylpyridin-2-one;methanol |
|---|---|
| PubChem CID | 162730321 |
| Molecular Formula | C24H37F2N7O3 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | acetaldehyde;1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)pyrazin-2-yl]prop-2-enyl]-5-propylpyridin-2-one;methanol |
| SMILES | CC=O.CCCc1ccc(=O)n(C/C(=C(/N)c2cnc(N3CCCC(F)(F)C3)cn2)N(C)N)c1.CO |
| InChI | InChI=1S/C21H29F2N7O.C2H4O.CH4O/c1-3-5-15-6-7-19(31)30(12-15)13-17(28(2)25)20(24)16-10-27-18(11-26-16)29-9-4-8-21(22,23)14-29;1-2-3;1-2/h6-7,10-12H,3-5,8-9,13-14,24-25H2,1-2H3;2H,1H3;2H,1H3/b20-17-;; |
| InChIKey | DGFJFRPQKNJZTN-RMBYUSIPSA-N |
| XLogP | 1.77 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|