C13H21NO — CID 162738010
ethane;(5Z,6Z)-5-ethylidene-1-iminonona-6,8-dien-2-one (PubChem CID 162738010) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;(5Z,6Z)-5-ethylidene-1-iminonona-6,8-dien-2-one.
| Compound Name | ethane;(5Z,6Z)-5-ethylidene-1-iminonona-6,8-dien-2-one |
|---|---|
| PubChem CID | 162738010 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;(5Z,6Z)-5-ethylidene-1-iminonona-6,8-dien-2-one |
| SMILES | CC.[H]/N=C/C(=O)CCC(/C=C\C=C)=C/C |
| InChI | InChI=1S/C11H15NO.C2H6/c1-3-5-6-10(4-2)7-8-11(13)9-12;1-2/h3-6,9,12H,1,7-8H2,2H3;1-2H3/b6-5-,10-4+,12-9+; |
| InChIKey | AECJMHMIJRJMJW-JXWWYSCYSA-N |
| XLogP | 3.70 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|