C23H23INO2P — CID 162743940
4-[[iodo(triphenyl)-λ5-phosphanyl]methyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 162743940) has the molecular formula C23H23INO2P and a molecular weight of 503.32 g/mol. Its IUPAC name is 4-[[iodo(triphenyl)-λ5-phosphanyl]methyl]-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | 4-[[iodo(triphenyl)-λ5-phosphanyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162743940 |
| Molecular Formula | C23H23INO2P |
| Molecular Weight | 503.32 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 4-[[iodo(triphenyl)-λ5-phosphanyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23INO2P/c1-25-19(17-27-23(25)26)18-28(24,20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3 |
| InChIKey | ATPNQVQQZWBVAT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|