About tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate
tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate (PubChem CID 162750344) has the molecular formula C19H35NO7
and a molecular weight of 389.49 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate |
| PubChem CID | 162750344 |
| Molecular Formula | C19H35NO7 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate |
| SMILES | C=CC(=O)OC(C)(C)C.CC(C)(C)OC(=O)N1CCCC1.COC(=O)CO |
| InChI | InChI=1S/C9H17NO2.C7H12O2.C3H6O3/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-5-6(8)9-7(2,3)4;1-6-3(5)2-4/h4-7H2,1-3H3;5H,1H2,2-4H3;4H,2H2,1H3 |
| InChIKey | DBJRNKVPYOEREZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate?
The IUPAC name of tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate (CID 162750344) is tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate.
What is the SMILES notation for tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate?
The canonical SMILES for tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate is C=CC(=O)OC(C)(C)C.CC(C)(C)OC(=O)N1CCCC1.COC(=O)CO.
What is the InChIKey of tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate?
The InChIKey is DBJRNKVPYOEREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C7H12O2.C3H6O3/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-5-6(8)9-7(2,3)4;1-6-3(5)2-4/h4-7H2,1-3H3;5H,1H2,2-4H3;4H,2H2,1H3.
What are the key properties of tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate?
tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate has a molecular weight of 389.49 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;tert-butyl pyrrolidine-1-carboxylate;methyl 2-hydroxyacetate is sourced from PubChem (CID 162750344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).