C14H21Cl2N3 — CID 162764573
cycloheptane;3,5-dichloro-5,6,7,8-tetrahydropyrido[2,3-c]pyridazine (PubChem CID 162764573) has the molecular formula C14H21Cl2N3 and a molecular weight of 302.25 g/mol. Its IUPAC name is cycloheptane;3,5-dichloro-5,6,7,8-tetrahydropyrido[2,3-c]pyridazine.
| Compound Name | cycloheptane;3,5-dichloro-5,6,7,8-tetrahydropyrido[2,3-c]pyridazine |
|---|---|
| PubChem CID | 162764573 |
| Molecular Formula | C14H21Cl2N3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | cycloheptane;3,5-dichloro-5,6,7,8-tetrahydropyrido[2,3-c]pyridazine |
| SMILES | C1CCCCCC1.Clc1cc2c(nn1)NCCC2Cl |
| InChI | InChI=1S/C7H7Cl2N3.C7H14/c8-5-1-2-10-7-4(5)3-6(9)11-12-7;1-2-4-6-7-5-3-1/h3,5H,1-2H2,(H,10,12);1-7H2 |
| InChIKey | MGDMLLOLVGKTLU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|