C31H36N4O4 — CID 162769858
3-[7-[5-[4-isocyano-4-(4-methoxyphenyl)piperidin-1-yl]pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162769858) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-[7-[5-[4-isocyano-4-(4-methoxyphenyl)piperidin-1-yl]pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[5-[4-isocyano-4-(4-methoxyphenyl)piperidin-1-yl]pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162769858 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 3-[7-[5-[4-isocyano-4-(4-methoxyphenyl)piperidin-1-yl]pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [C-]#[N+]C1(c2ccc(OC)cc2)CCN(CCCCCc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C31H36N4O4/c1-32-31(23-10-12-24(39-2)13-11-23)16-19-34(20-17-31)18-5-3-4-7-22-8-6-9-25-26(22)21-35(30(25)38)27-14-15-28(36)33-29(27)37/h6,8-13,27H,3-5,7,14-21H2,2H3,(H,33,36,37) |
| InChIKey | AYBJQKXCGYDEGQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|