C32H38N4O3 — CID 146479765
1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butyl]-4-(2,4,6-trimethylphenyl)piperidine-4-carbonitrile (PubChem CID 146479765) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butyl]-4-(2,4,6-trimethylphenyl)piperidine-4-carbonitrile.
| Compound Name | 1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butyl]-4-(2,4,6-trimethylphenyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 146479765 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butyl]-4-(2,4,6-trimethylphenyl)piperidine-4-carbonitrile |
| SMILES | Cc1cc(C)c(C2(C#N)CCN(CCCCc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)c(C)c1 |
| InChI | InChI=1S/C32H38N4O3/c1-21-17-22(2)29(23(3)18-21)32(20-33)12-15-35(16-13-32)14-5-4-7-24-8-6-9-25-26(24)19-36(31(25)39)27-10-11-28(37)34-30(27)38/h6,8-9,17-18,27H,4-5,7,10-16,19H2,1-3H3,(H,34,37,38) |
| InChIKey | NQRQXJAGZMVUAQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|