C30H33F3N4O4 — CID 178078021
3-[3-oxo-7-[5-[6-(trifluoromethyl)spiro[2H-furo[3,2-b]pyridine-3,4'-piperidine]-1'-yl]pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 178078021) has the molecular formula C30H33F3N4O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is 3-[3-oxo-7-[5-[6-(trifluoromethyl)spiro[2H-furo[3,2-b]pyridine-3,4'-piperidine]-1'-yl]pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[5-[6-(trifluoromethyl)spiro[2H-furo[3,2-b]pyridine-3,4'-piperidine]-1'-yl]pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178078021 |
| Molecular Formula | C30H33F3N4O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-[3-oxo-7-[5-[6-(trifluoromethyl)spiro[2H-furo[3,2-b]pyridine-3,4'-piperidine]-1'-yl]pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CCCCCN4CCC5(CC4)COc4cc(C(F)(F)F)cnc45)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H33F3N4O4/c31-30(32,33)20-15-24-26(34-16-20)29(18-41-24)10-13-36(14-11-29)12-3-1-2-5-19-6-4-7-21-22(19)17-37(28(21)40)23-8-9-25(38)35-27(23)39/h4,6-7,15-16,23H,1-3,5,8-14,17-18H2,(H,35,38,39) |
| InChIKey | NYDCZSIJRCWROR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|