C30H32ClN3O5 — CID 146480005
3-[7-[5-(5-chloro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-yl)pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146480005) has the molecular formula C30H32ClN3O5 and a molecular weight of 550.06 g/mol. Its IUPAC name is 3-[7-[5-(5-chloro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-yl)pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[5-(5-chloro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-yl)pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146480005 |
| Molecular Formula | C30H32ClN3O5 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 3-[7-[5-(5-chloro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-yl)pentyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CCCCCN4CCC5(CC4)OC(=O)c4cc(Cl)ccc45)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H32ClN3O5/c31-20-8-9-24-22(17-20)29(38)39-30(24)12-15-33(16-13-30)14-3-1-2-5-19-6-4-7-21-23(19)18-34(28(21)37)25-10-11-26(35)32-27(25)36/h4,6-9,17,25H,1-3,5,10-16,18H2,(H,32,35,36) |
| InChIKey | XSEMTUZTGJKCOW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|