C29H32ClN3O5 — CID 146479903
3-[7-[4-(5-chlorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146479903) has the molecular formula C29H32ClN3O5 and a molecular weight of 538.04 g/mol. Its IUPAC name is 3-[7-[4-(5-chlorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-(5-chlorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146479903 |
| Molecular Formula | C29H32ClN3O5 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 3-[7-[4-(5-chlorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCCCCN4CCC5(CC4)OCc4ccc(Cl)cc45)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H32ClN3O5/c30-20-7-6-19-18-38-29(23(19)16-20)10-13-32(14-11-29)12-1-2-15-37-25-5-3-4-21-22(25)17-33(28(21)36)24-8-9-26(34)31-27(24)35/h3-7,16,24H,1-2,8-15,17-18H2,(H,31,34,35) |
| InChIKey | NQMJGHBTPLFGPW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|