C23H34O2 — CID 162770566
4-[3-[(1S)-1-hydroxyheptyl]-1-adamantyl]phenol (PubChem CID 162770566) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 4-[3-[(1S)-1-hydroxyheptyl]-1-adamantyl]phenol.
| Compound Name | 4-[3-[(1S)-1-hydroxyheptyl]-1-adamantyl]phenol |
|---|---|
| PubChem CID | 162770566 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 4-[3-[(1S)-1-hydroxyheptyl]-1-adamantyl]phenol |
| SMILES | CCCCCC[C@H](O)C12CC3CC(CC(c4ccc(O)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C23H34O2/c1-2-3-4-5-6-21(25)23-14-17-11-18(15-23)13-22(12-17,16-23)19-7-9-20(24)10-8-19/h7-10,17-18,21,24-25H,2-6,11-16H2,1H3/t17?,18?,21-,22?,23?/m0/s1 |
| InChIKey | CXCGSVAWQUNREE-VLRBRYLVSA-N |
| XLogP | 5.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|