C16H22N4OS — CID 162773608
2-(cyanoamino)-N-(2-cyclohexyl-1,3-thiazol-5-yl)-1-methylcyclobutane-1-carboxamide (PubChem CID 162773608) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-(cyanoamino)-N-(2-cyclohexyl-1,3-thiazol-5-yl)-1-methylcyclobutane-1-carboxamide.
| Compound Name | 2-(cyanoamino)-N-(2-cyclohexyl-1,3-thiazol-5-yl)-1-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 162773608 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(cyanoamino)-N-(2-cyclohexyl-1,3-thiazol-5-yl)-1-methylcyclobutane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2cnc(C3CCCCC3)s2)CCC1NC#N |
| InChI | InChI=1S/C16H22N4OS/c1-16(8-7-12(16)19-10-17)15(21)20-13-9-18-14(22-13)11-5-3-2-4-6-11/h9,11-12,19H,2-8H2,1H3,(H,20,21) |
| InChIKey | ZRUFCWXLWHDQQF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|