C19H24O4 — CID 162773804
4-O-tert-butyl 1-O-phenyl (3S,4R)-3-methylcyclohexene-1,4-dicarboxylate (PubChem CID 162773804) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-phenyl (3S,4R)-3-methylcyclohexene-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-phenyl (3S,4R)-3-methylcyclohexene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 162773804 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-O-tert-butyl 1-O-phenyl (3S,4R)-3-methylcyclohexene-1,4-dicarboxylate |
| SMILES | C[C@H]1C=C(C(=O)Oc2ccccc2)CC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24O4/c1-13-12-14(17(20)22-15-8-6-5-7-9-15)10-11-16(13)18(21)23-19(2,3)4/h5-9,12-13,16H,10-11H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | HJSSYFBOTYARNL-XJKSGUPXSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|