C17H24O2 — CID 162788233
(1R,9S,12R)-5,9-dimethyl-12-propan-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-3-ol (PubChem CID 162788233) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,9S,12R)-5,9-dimethyl-12-propan-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-3-ol.
| Compound Name | (1R,9S,12R)-5,9-dimethyl-12-propan-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 162788233 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1R,9S,12R)-5,9-dimethyl-12-propan-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-3-ol |
| SMILES | Cc1cc(O)c2c(c1)O[C@@]1(C)CC[C@H](C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C17H24O2/c1-10(2)12-5-6-17(4)9-13(12)16-14(18)7-11(3)8-15(16)19-17/h7-8,10,12-13,18H,5-6,9H2,1-4H3/t12-,13-,17+/m1/s1 |
| InChIKey | MXMBNQJGJFSEPP-XNJGSVPQSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |