C19H32O4 — CID 162800895
methyl 11-hydroxy-11-(3-pent-2-enyloxiran-2-yl)undec-10-enoate (PubChem CID 162800895) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is methyl 11-hydroxy-11-(3-pent-2-enyloxiran-2-yl)undec-10-enoate.
| Compound Name | methyl 11-hydroxy-11-(3-pent-2-enyloxiran-2-yl)undec-10-enoate |
|---|---|
| PubChem CID | 162800895 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | methyl 11-hydroxy-11-(3-pent-2-enyloxiran-2-yl)undec-10-enoate |
| SMILES | CCC=CCC1OC1C(O)=CCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O4/c1-3-4-10-14-17-19(23-17)16(20)13-11-8-6-5-7-9-12-15-18(21)22-2/h4,10,13,17,19-20H,3,5-9,11-12,14-15H2,1-2H3 |
| InChIKey | KPCIBZZVNONBKG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|