C17H23Br2ClO3 — CID 162801105
[(2R,3S,5R,6S,8R)-3,6-dibromo-8-[(Z)-1-chlorohex-3-en-5-ynyl]-2-ethyloxocan-5-yl] acetate (PubChem CID 162801105) has the molecular formula C17H23Br2ClO3 and a molecular weight of 470.63 g/mol. Its IUPAC name is [(2R,3S,5R,6S,8R)-3,6-dibromo-8-[(Z)-1-chlorohex-3-en-5-ynyl]-2-ethyloxocan-5-yl] acetate.
| Compound Name | [(2R,3S,5R,6S,8R)-3,6-dibromo-8-[(Z)-1-chlorohex-3-en-5-ynyl]-2-ethyloxocan-5-yl] acetate |
|---|---|
| PubChem CID | 162801105 |
| Molecular Formula | C17H23Br2ClO3 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | [(2R,3S,5R,6S,8R)-3,6-dibromo-8-[(Z)-1-chlorohex-3-en-5-ynyl]-2-ethyloxocan-5-yl] acetate |
| SMILES | C#C/C=C\CC(Cl)[C@H]1C[C@H](Br)[C@H](OC(C)=O)C[C@H](Br)[C@@H](CC)O1 |
| InChI | InChI=1S/C17H23Br2ClO3/c1-4-6-7-8-14(20)17-10-13(19)16(22-11(3)21)9-12(18)15(5-2)23-17/h1,6-7,12-17H,5,8-10H2,2-3H3/b7-6-/t12-,13-,14?,15+,16+,17+/m0/s1 |
| InChIKey | POXMPQJRUHCCSF-CVSFLNDXSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|