C17H22BrClO3 — CID 163107099
[(2R,4R,5R,6Z,8R)-4-bromo-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-3,4,5,8-tetrahydro-2H-oxocin-5-yl] acetate (PubChem CID 163107099) has the molecular formula C17H22BrClO3 and a molecular weight of 389.72 g/mol. Its IUPAC name is [(2R,4R,5R,6Z,8R)-4-bromo-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-3,4,5,8-tetrahydro-2H-oxocin-5-yl] acetate.
| Compound Name | [(2R,4R,5R,6Z,8R)-4-bromo-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-3,4,5,8-tetrahydro-2H-oxocin-5-yl] acetate |
|---|---|
| PubChem CID | 163107099 |
| Molecular Formula | C17H22BrClO3 |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [(2R,4R,5R,6Z,8R)-4-bromo-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-3,4,5,8-tetrahydro-2H-oxocin-5-yl] acetate |
| SMILES | C#C/C=C\CC(Cl)[C@H]1C[C@@H](Br)[C@H](OC(C)=O)/C=C\[C@@H](CC)O1 |
| InChI | InChI=1S/C17H22BrClO3/c1-4-6-7-8-15(19)17-11-14(18)16(21-12(3)20)10-9-13(5-2)22-17/h1,6-7,9-10,13-17H,5,8,11H2,2-3H3/b7-6-,10-9-/t13-,14-,15?,16-,17-/m1/s1 |
| InChIKey | AGJWJXGLNWTDOA-MTQKPOHKSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|