C17H23ClO4 — CID 163188309
[(2R,4R,5R,8R)-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-5-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl] acetate (PubChem CID 163188309) has the molecular formula C17H23ClO4 and a molecular weight of 326.82 g/mol. Its IUPAC name is [(2R,4R,5R,8R)-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-5-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl] acetate.
| Compound Name | [(2R,4R,5R,8R)-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-5-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl] acetate |
|---|---|
| PubChem CID | 163188309 |
| Molecular Formula | C17H23ClO4 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(2R,4R,5R,8R)-2-[(Z)-1-chlorohex-3-en-5-ynyl]-8-ethyl-5-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl] acetate |
| SMILES | C#C/C=C\CC(Cl)[C@H]1C[C@@H](OC(C)=O)[C@H](O)C=C[C@@H](CC)O1 |
| InChI | InChI=1S/C17H23ClO4/c1-4-6-7-8-14(18)16-11-17(21-12(3)19)15(20)10-9-13(5-2)22-16/h1,6-7,9-10,13-17,20H,5,8,11H2,2-3H3/b7-6-,10-9?/t13-,14?,15-,16-,17-/m1/s1 |
| InChIKey | QUFYLYOBGYXOHP-YEXOBJAXSA-N |
| XLogP | 2.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|