C17H23BrO3 — CID 73089078
[5-(1-bromohex-3-enyl)-2-pent-2-en-4-ynyloxolan-3-yl] acetate (PubChem CID 73089078) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is [5-(1-bromohex-3-enyl)-2-pent-2-en-4-ynyloxolan-3-yl] acetate.
| Compound Name | [5-(1-bromohex-3-enyl)-2-pent-2-en-4-ynyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 73089078 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [5-(1-bromohex-3-enyl)-2-pent-2-en-4-ynyloxolan-3-yl] acetate |
| SMILES | C#CC=CCC1OC(C(Br)CC=CCC)CC1OC(C)=O |
| InChI | InChI=1S/C17H23BrO3/c1-4-6-8-10-14(18)16-12-17(20-13(3)19)15(21-16)11-9-7-5-2/h2,6-9,14-17H,4,10-12H2,1,3H3 |
| InChIKey | BUFQJMZKMZGEFE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|