C19H27BrO6 — CID 163006775
[2-(2-acetyloxy-3-bromooct-5-enyl)-5-propa-1,2-dienoxyoxolan-3-yl] acetate (PubChem CID 163006775) has the molecular formula C19H27BrO6 and a molecular weight of 431.32 g/mol. Its IUPAC name is [2-(2-acetyloxy-3-bromooct-5-enyl)-5-propa-1,2-dienoxyoxolan-3-yl] acetate.
| Compound Name | [2-(2-acetyloxy-3-bromooct-5-enyl)-5-propa-1,2-dienoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 163006775 |
| Molecular Formula | C19H27BrO6 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [2-(2-acetyloxy-3-bromooct-5-enyl)-5-propa-1,2-dienoxyoxolan-3-yl] acetate |
| SMILES | C=C=COC1CC(OC(C)=O)C(CC(OC(C)=O)C(Br)CC=CCC)O1 |
| InChI | InChI=1S/C19H27BrO6/c1-5-7-8-9-15(20)16(24-13(3)21)11-17-18(25-14(4)22)12-19(26-17)23-10-6-2/h7-8,10,15-19H,2,5,9,11-12H2,1,3-4H3 |
| InChIKey | IMRACKARKRJJBV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|