C20H14O6 — CID 162815421
4,9,10,11,12-pentahydroxy-11,12-dihydro-10H-perylen-3-one (PubChem CID 162815421) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is 4,9,10,11,12-pentahydroxy-11,12-dihydro-10H-perylen-3-one.
| Compound Name | 4,9,10,11,12-pentahydroxy-11,12-dihydro-10H-perylen-3-one |
|---|---|
| PubChem CID | 162815421 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4,9,10,11,12-pentahydroxy-11,12-dihydro-10H-perylen-3-one |
| SMILES | O=C1C=Cc2c3c4c(c(O)ccc4c4ccc(O)c1c24)C(O)C(O)C3O |
| InChI | InChI=1S/C20H14O6/c21-10-4-1-7-8-2-5-12(23)17-14(8)15(18(24)20(26)19(17)25)9-3-6-11(22)16(10)13(7)9/h1-6,18-21,23-26H |
| InChIKey | LYFFSXMYKSNTOT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|