C28H22O8 — CID 162815471
(5,12,18-trihydroxy-16,23-dimethyl-3,10-dioxo-22-oxahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1,4(9),5,7,11,13(25),14(19),15,17-nonaen-24-yl) acetate (PubChem CID 162815471) has the molecular formula C28H22O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is (5,12,18-trihydroxy-16,23-dimethyl-3,10-dioxo-22-oxahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1,4(9),5,7,11,13(25),14(19),15,17-nonaen-24-yl) acetate.
| Compound Name | (5,12,18-trihydroxy-16,23-dimethyl-3,10-dioxo-22-oxahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1,4(9),5,7,11,13(25),14(19),15,17-nonaen-24-yl) acetate |
|---|---|
| PubChem CID | 162815471 |
| Molecular Formula | C28H22O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (5,12,18-trihydroxy-16,23-dimethyl-3,10-dioxo-22-oxahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1,4(9),5,7,11,13(25),14(19),15,17-nonaen-24-yl) acetate |
| SMILES | CC(=O)OC1c2c3c(c(O)c4c2C(Cc2c(O)cc(C)cc2-4)OC1C)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C28H22O8/c1-10-7-15-14(17(31)8-10)9-18-21-20(15)27(34)24-22(23(21)28(11(2)35-18)36-12(3)29)26(33)19-13(25(24)32)5-4-6-16(19)30/h4-8,11,18,28,30-31,34H,9H2,1-3H3 |
| InChIKey | HTMHRMTVLWOVAR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|