C28H43NO4 — CID 162818737
(10,12-dihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-yl) formate (PubChem CID 162818737) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is (10,12-dihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-yl) formate.
| Compound Name | (10,12-dihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-yl) formate |
|---|---|
| PubChem CID | 162818737 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | (10,12-dihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-yl) formate |
| SMILES | CC1CCC2N(C1)CC1C3CC4C(CC=C5CC(OC=O)CCC54C)C3CC(O)C1C2(C)O |
| InChI | InChI=1S/C28H43NO4/c1-16-4-7-25-28(3,32)26-22(14-29(25)13-16)20-11-23-19(21(20)12-24(26)31)6-5-17-10-18(33-15-30)8-9-27(17,23)2/h5,15-16,18-26,31-32H,4,6-14H2,1-3H3 |
| InChIKey | VNWXSCOWIQXPES-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|