C26H39NO3 — CID 162834707
2-amino-2-[1-[3-(4-hydroxy-3,4-dihydro-2H-pyran-2-yl)cyclohexyl]-6-methyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde (PubChem CID 162834707) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is 2-amino-2-[1-[3-(4-hydroxy-3,4-dihydro-2H-pyran-2-yl)cyclohexyl]-6-methyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde.
| Compound Name | 2-amino-2-[1-[3-(4-hydroxy-3,4-dihydro-2H-pyran-2-yl)cyclohexyl]-6-methyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 162834707 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 2-amino-2-[1-[3-(4-hydroxy-3,4-dihydro-2H-pyran-2-yl)cyclohexyl]-6-methyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde |
| SMILES | C=C1CCC2C(C3CC(C)CC13)C2(C(N)C=O)C1CCCC(C2CC(O)C=CO2)C1 |
| InChI | InChI=1S/C26H39NO3/c1-15-10-20-16(2)6-7-22-25(21(20)11-15)26(22,24(27)14-28)18-5-3-4-17(12-18)23-13-19(29)8-9-30-23/h8-9,14-15,17-25,29H,2-7,10-13,27H2,1H3 |
| InChIKey | BAUZZPLVKFJRAA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|