C24H28O11 — CID 162842039
(4S)-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylidene]cyclopentene-1-carboxylic acid (PubChem CID 162842039) has the molecular formula C24H28O11 and a molecular weight of 492.48 g/mol. Its IUPAC name is (4S)-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylidene]cyclopentene-1-carboxylic acid.
| Compound Name | (4S)-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylidene]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 162842039 |
| Molecular Formula | C24H28O11 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (4S)-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylidene]cyclopentene-1-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(=CCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](OC(=O)C=Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C24H28O11/c1-12-10-16(34-18(27)7-4-13-2-5-14(26)6-3-13)15(19(12)23(31)32)8-9-33-24-22(30)21(29)20(28)17(11-25)35-24/h2-8,16-17,20-22,24-26,28-30H,9-11H2,1H3,(H,31,32)/t16-,17+,20+,21-,22+,24-/m0/s1 |
| InChIKey | CBJNLOVRAFQEQH-WGCIZREYSA-N |
| XLogP | -0.14 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|