C15H12O9S — CID 162844504
[(2S,3S)-3-(3,4-dihydroxyphenyl)-6-formyl-2,3-dihydro-1,4-benzodioxin-2-yl] hydrogen sulfate (PubChem CID 162844504) has the molecular formula C15H12O9S and a molecular weight of 368.32 g/mol. Its IUPAC name is [(2S,3S)-3-(3,4-dihydroxyphenyl)-6-formyl-2,3-dihydro-1,4-benzodioxin-2-yl] hydrogen sulfate.
| Compound Name | [(2S,3S)-3-(3,4-dihydroxyphenyl)-6-formyl-2,3-dihydro-1,4-benzodioxin-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162844504 |
| Molecular Formula | C15H12O9S |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [(2S,3S)-3-(3,4-dihydroxyphenyl)-6-formyl-2,3-dihydro-1,4-benzodioxin-2-yl] hydrogen sulfate |
| SMILES | O=Cc1ccc2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@H](OS(=O)(=O)O)O2 |
| InChI | InChI=1S/C15H12O9S/c16-7-8-1-4-12-13(5-8)22-14(15(23-12)24-25(19,20)21)9-2-3-10(17)11(18)6-9/h1-7,14-15,17-18H,(H,19,20,21)/t14-,15-/m0/s1 |
| InChIKey | HRSCGKVISDRQDA-GJZGRUSLSA-N |
| XLogP | 1.57 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|