C26H20O10 — CID 25017443
(E)-3-[4-[[(2R,3S)-6-[(E)-2-carboxyethenyl]-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]oxy]-3-hydroxyphenyl]prop-2-enoic acid (PubChem CID 25017443) has the molecular formula C26H20O10 and a molecular weight of 492.44 g/mol. Its IUPAC name is (E)-3-[4-[[(2R,3S)-6-[(E)-2-carboxyethenyl]-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]oxy]-3-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(2R,3S)-6-[(E)-2-carboxyethenyl]-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]oxy]-3-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25017443 |
| Molecular Formula | C26H20O10 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (E)-3-[4-[[(2R,3S)-6-[(E)-2-carboxyethenyl]-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]oxy]-3-hydroxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(O[C@@H]2Oc3ccc(/C=C/C(=O)O)cc3O[C@H]2c2ccc(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C26H20O10/c27-17-6-5-16(13-18(17)28)25-26(35-20-7-1-14(11-19(20)29)3-9-23(30)31)36-21-8-2-15(4-10-24(32)33)12-22(21)34-25/h1-13,25-29H,(H,30,31)(H,32,33)/b9-3+,10-4+/t25-,26+/m0/s1 |
| InChIKey | NYLJJVIUBPKYLZ-OHLOQLRVSA-N |
| XLogP | 3.92 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|