C24H20O14S2 — CID 74342457
2-[2-(3,4-dihydroxyphenyl)-3-[2-hydroxy-4-(2-sulfooxyethenyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl hydrogen sulfate (PubChem CID 74342457) has the molecular formula C24H20O14S2 and a molecular weight of 596.54 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)-3-[2-hydroxy-4-(2-sulfooxyethenyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl hydrogen sulfate.
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)-3-[2-hydroxy-4-(2-sulfooxyethenyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl hydrogen sulfate |
|---|---|
| PubChem CID | 74342457 |
| Molecular Formula | C24H20O14S2 |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)-3-[2-hydroxy-4-(2-sulfooxyethenyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC=Cc1ccc(OC2Oc3cc(C=COS(=O)(=O)O)ccc3OC2c2ccc(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C24H20O14S2/c25-17-4-3-16(13-18(17)26)23-24(37-20-5-1-14(11-19(20)27)7-9-34-39(28,29)30)38-22-12-15(2-6-21(22)36-23)8-10-35-40(31,32)33/h1-13,23-27H,(H,28,29,30)(H,31,32,33) |
| InChIKey | CWEROGPFFUKOGE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 215.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|