C18H20N6O4 — CID 162889098
2-[2-[(2R,3R)-2-(diaminomethylideneamino)-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl]guanidine (PubChem CID 162889098) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[2-[(2R,3R)-2-(diaminomethylideneamino)-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl]guanidine.
| Compound Name | 2-[2-[(2R,3R)-2-(diaminomethylideneamino)-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl]guanidine |
|---|---|
| PubChem CID | 162889098 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[2-[(2R,3R)-2-(diaminomethylideneamino)-3-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl]guanidine |
| SMILES | NC(N)=NC=Cc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](N=C(N)N)O2 |
| InChI | InChI=1S/C18H20N6O4/c19-17(20)23-6-5-9-1-4-13-14(7-9)27-15(16(28-13)24-18(21)22)10-2-3-11(25)12(26)8-10/h1-8,15-16,25-26H,(H4,19,20,23)(H4,21,22,24)/t15-,16-/m1/s1 |
| InChIKey | MCLIKJGPKULDHY-HZPDHXFCSA-N |
| XLogP | 0.45 |
| TPSA | 187.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|