C23H28O10 — CID 162852958
methyl (2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]oxane-2-carboxylate (PubChem CID 162852958) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 162852958 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](O[C@H]2CCc3ccccc3C2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O10/c1-12(24)29-18-19(30-13(2)25)21(31-14(3)26)23(33-20(18)22(27)28-4)32-17-10-9-15-7-5-6-8-16(15)11-17/h5-8,17-21,23H,9-11H2,1-4H3/t17-,18-,19+,20-,21+,23+/m0/s1 |
| InChIKey | QJPRLABWWYKRGN-QWTBPSOFSA-N |
| XLogP | 1.25 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|