C25H36O6 — CID 162869781
(2S,3S,4R,5R)-2-[[(4R,6S,6aR,9S)-1-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl]oxy]oxane-3,4,5-triol (PubChem CID 162869781) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[(4R,6S,6aR,9S)-1-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-[[(4R,6S,6aR,9S)-1-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162869781 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[(4R,6S,6aR,9S)-1-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@H]2CC[C@H](C)c3c(O)c(O[C@@H]4OC[C@@H](O)[C@@H](O)[C@@H]4O)c(C)c1c32 |
| InChI | InChI=1S/C25H36O6/c1-11(2)8-15-9-13(4)16-7-6-12(3)18-20(16)19(15)14(5)24(22(18)28)31-25-23(29)21(27)17(26)10-30-25/h8,12-13,15-17,21,23,25-29H,6-7,9-10H2,1-5H3/t12-,13-,15-,16+,17+,21+,23-,25-/m0/s1 |
| InChIKey | MWZXYPPIOWWIFA-XZQFBTDHSA-N |
| XLogP | 3.59 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|