C12H16O6 — CID 163023546
(2R,3R,4S,5R)-2-(3-hydroxy-5-methylphenoxy)oxane-3,4,5-triol (PubChem CID 163023546) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(3-hydroxy-5-methylphenoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(3-hydroxy-5-methylphenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163023546 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(3-hydroxy-5-methylphenoxy)oxane-3,4,5-triol |
| SMILES | Cc1cc(O)cc(O[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C12H16O6/c1-6-2-7(13)4-8(3-6)18-12-11(16)10(15)9(14)5-17-12/h2-4,9-16H,5H2,1H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | ZTHJDVHNGYKCSH-WRWGMCAJSA-N |
| XLogP | -0.48 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |