C17H22O5 — CID 162873077
10-hepta-1,3-dienyl-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one (PubChem CID 162873077) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 10-hepta-1,3-dienyl-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one.
| Compound Name | 10-hepta-1,3-dienyl-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 162873077 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 10-hepta-1,3-dienyl-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES | C=C1OC(=O)C2(C(C=CC=CCCC)C=CC(O)C2O)C1O |
| InChI | InChI=1S/C17H22O5/c1-3-4-5-6-7-8-12-9-10-13(18)15(20)17(12)14(19)11(2)22-16(17)21/h5-10,12-15,18-20H,2-4H2,1H3 |
| InChIKey | LMEOQXMUHQUZJM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|