C16H20O5 — CID 146682650
(1S,2R,3S,5R,6S,9R)-2-hydroxy-3-methoxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one (PubChem CID 146682650) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1S,2R,3S,5R,6S,9R)-2-hydroxy-3-methoxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one.
| Compound Name | (1S,2R,3S,5R,6S,9R)-2-hydroxy-3-methoxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one |
|---|---|
| PubChem CID | 146682650 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1S,2R,3S,5R,6S,9R)-2-hydroxy-3-methoxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one |
| SMILES | C/C=C/C=C/[C@@H]1C=C[C@@H]2OC(=O)[C@@]13[C@H]2O[C@](C)(OC)[C@@H]3O |
| InChI | InChI=1S/C16H20O5/c1-4-5-6-7-10-8-9-11-12-16(10,14(18)20-11)13(17)15(2,19-3)21-12/h4-13,17H,1-3H3/b5-4+,7-6+/t10-,11+,12+,13+,15+,16-/m1/s1 |
| InChIKey | MJAFWIRCTYVRRH-CCODMLIUSA-N |
| XLogP | 1.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|