C26H40O3 — CID 162873136
4-[(1R)-1-ethoxyethyl]-5-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol (PubChem CID 162873136) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 4-[(1R)-1-ethoxyethyl]-5-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol.
| Compound Name | 4-[(1R)-1-ethoxyethyl]-5-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 162873136 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 4-[(1R)-1-ethoxyethyl]-5-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol |
| SMILES | CCO[C@H](C)c1c(C)cc(O)c(CC=C(C)CCC=C(C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C26H40O3/c1-8-29-22(7)25-21(6)17-24(27)23(26(25)28)16-15-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,15,17,22,27-28H,8-10,12,14,16H2,1-7H3/t22-/m1/s1 |
| InChIKey | QCTPGZQDYNRTJA-JOCHJYFZSA-N |
| XLogP | 7.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|