C20H14O9 — CID 162874439
2,8,11,12,17-pentahydroxy-19-oxapentacyclo[10.8.1.02,11.04,9.013,18]henicosa-4(9),5,7,13(18),14,16-hexaene-3,10,20-trione (PubChem CID 162874439) has the molecular formula C20H14O9 and a molecular weight of 398.32 g/mol. Its IUPAC name is 2,8,11,12,17-pentahydroxy-19-oxapentacyclo[10.8.1.02,11.04,9.013,18]henicosa-4(9),5,7,13(18),14,16-hexaene-3,10,20-trione.
| Compound Name | 2,8,11,12,17-pentahydroxy-19-oxapentacyclo[10.8.1.02,11.04,9.013,18]henicosa-4(9),5,7,13(18),14,16-hexaene-3,10,20-trione |
|---|---|
| PubChem CID | 162874439 |
| Molecular Formula | C20H14O9 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2,8,11,12,17-pentahydroxy-19-oxapentacyclo[10.8.1.02,11.04,9.013,18]henicosa-4(9),5,7,13(18),14,16-hexaene-3,10,20-trione |
| SMILES | O=C1Oc2c(O)cccc2C2(O)CC1C1(O)C(=O)c3cccc(O)c3C(=O)C21O |
| InChI | InChI=1S/C20H14O9/c21-11-5-1-3-8-13(11)16(24)20(28)18(26)7-10(19(20,27)15(8)23)17(25)29-14-9(18)4-2-6-12(14)22/h1-6,10,21-22,26-28H,7H2 |
| InChIKey | SKQLXOHDIVIJKS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|