C28H16O8 — CID 15975085
(1R,13R,15R,16S)-8,23-dihydroxynonacyclo[14.11.1.02,11.02,15.04,9.011,26.013,17.017,26.019,24]octacosa-4(9),5,7,19(24),20,22-hexaene-3,10,12,18,25,27-hexone (PubChem CID 15975085) has the molecular formula C28H16O8 and a molecular weight of 480.43 g/mol. Its IUPAC name is (1R,13R,15R,16S)-8,23-dihydroxynonacyclo[14.11.1.02,11.02,15.04,9.011,26.013,17.017,26.019,24]octacosa-4(9),5,7,19(24),20,22-hexaene-3,10,12,18,25,27-hexone.
| Compound Name | (1R,13R,15R,16S)-8,23-dihydroxynonacyclo[14.11.1.02,11.02,15.04,9.011,26.013,17.017,26.019,24]octacosa-4(9),5,7,19(24),20,22-hexaene-3,10,12,18,25,27-hexone |
|---|---|
| PubChem CID | 15975085 |
| Molecular Formula | C28H16O8 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (1R,13R,15R,16S)-8,23-dihydroxynonacyclo[14.11.1.02,11.02,15.04,9.011,26.013,17.017,26.019,24]octacosa-4(9),5,7,19(24),20,22-hexaene-3,10,12,18,25,27-hexone |
| SMILES | O=C1c2cccc(O)c2C(=O)C23C(=O)[C@@H]4C[C@@H]5[C@@H]6C[C@@H](C(=O)C27C(=O)c2c(O)cccc2C(=O)C467)C153 |
| InChI | InChI=1S/C28H16O8/c29-15-5-1-3-9-17(15)23(35)27-22(34)14-7-11-12-8-13(25(11,27)19(9)31)21(33)28(27)24(36)18-10(4-2-6-16(18)30)20(32)26(12,14)28/h1-6,11-14,29-30H,7-8H2/t11-,12+,13-,14-,25?,26?,27?,28?/m0/s1 |
| InChIKey | YNGAOOBPJMGGOL-ATTXRYFASA-N |
| XLogP | 1.95 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|