C27H29NO6 — CID 162884652
N-[(1'S,5R,5'R,7S)-7-[2-(4-hydroxyphenyl)ethyl]-5'-methoxy-6-oxospiro[7,8-dihydrobenzo[f][1,3]benzodioxole-5,2'-cyclohex-3-ene]-1'-yl]-N-methylformamide (PubChem CID 162884652) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[(1'S,5R,5'R,7S)-7-[2-(4-hydroxyphenyl)ethyl]-5'-methoxy-6-oxospiro[7,8-dihydrobenzo[f][1,3]benzodioxole-5,2'-cyclohex-3-ene]-1'-yl]-N-methylformamide.
| Compound Name | N-[(1'S,5R,5'R,7S)-7-[2-(4-hydroxyphenyl)ethyl]-5'-methoxy-6-oxospiro[7,8-dihydrobenzo[f][1,3]benzodioxole-5,2'-cyclohex-3-ene]-1'-yl]-N-methylformamide |
|---|---|
| PubChem CID | 162884652 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[(1'S,5R,5'R,7S)-7-[2-(4-hydroxyphenyl)ethyl]-5'-methoxy-6-oxospiro[7,8-dihydrobenzo[f][1,3]benzodioxole-5,2'-cyclohex-3-ene]-1'-yl]-N-methylformamide |
| SMILES | CO[C@H]1C=C[C@]2(C(=O)[C@@H](CCc3ccc(O)cc3)Cc3cc4c(cc32)OCO4)[C@@H](N(C)C=O)C1 |
| InChI | InChI=1S/C27H29NO6/c1-28(15-29)25-13-21(32-2)9-10-27(25)22-14-24-23(33-16-34-24)12-19(22)11-18(26(27)31)6-3-17-4-7-20(30)8-5-17/h4-5,7-10,12,14-15,18,21,25,30H,3,6,11,13,16H2,1-2H3/t18-,21-,25-,27+/m0/s1 |
| InChIKey | UHEVSAVWQDYEQH-ONSJGJCPSA-N |
| XLogP | 3.16 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|