C35H44O8 — CID 162886025
(6R)-2-acetyl-4-[(8-butanoyl-5,7-dihydroxy-2,2-dimethylchromen-6-yl)methyl]-6-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one (PubChem CID 162886025) has the molecular formula C35H44O8 and a molecular weight of 592.73 g/mol. Its IUPAC name is (6R)-2-acetyl-4-[(8-butanoyl-5,7-dihydroxy-2,2-dimethylchromen-6-yl)methyl]-6-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one.
| Compound Name | (6R)-2-acetyl-4-[(8-butanoyl-5,7-dihydroxy-2,2-dimethylchromen-6-yl)methyl]-6-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162886025 |
| Molecular Formula | C35H44O8 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | (6R)-2-acetyl-4-[(8-butanoyl-5,7-dihydroxy-2,2-dimethylchromen-6-yl)methyl]-6-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one |
| SMILES | CCCC(=O)c1c(O)c(CC2=C(O)[C@@](C)(CC=C(C)CCC=C(C)C)C(=O)C(C(C)=O)=C2O)c(O)c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C35H44O8/c1-9-11-25(37)27-29(39)23(28(38)22-15-16-34(6,7)43-31(22)27)18-24-30(40)26(21(5)36)33(42)35(8,32(24)41)17-14-20(4)13-10-12-19(2)3/h12,14-16,38-41H,9-11,13,17-18H2,1-8H3/t35-/m1/s1 |
| InChIKey | JIVKKEDXPAIJAA-PGUFJCEWSA-N |
| XLogP | 7.69 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|