C20H22O4 — CID 162890441
4-[(2S,8S)-8-(2-hydroxypropan-2-yl)-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-2-yl]phenol (PubChem CID 162890441) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-[(2S,8S)-8-(2-hydroxypropan-2-yl)-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-2-yl]phenol.
| Compound Name | 4-[(2S,8S)-8-(2-hydroxypropan-2-yl)-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-2-yl]phenol |
|---|---|
| PubChem CID | 162890441 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[(2S,8S)-8-(2-hydroxypropan-2-yl)-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-2-yl]phenol |
| SMILES | CC(C)(O)[C@@H]1Cc2c(ccc3c2O[C@H](c2ccc(O)cc2)CC3)O1 |
| InChI | InChI=1S/C20H22O4/c1-20(2,22)18-11-15-17(23-18)10-6-13-5-9-16(24-19(13)15)12-3-7-14(21)8-4-12/h3-4,6-8,10,16,18,21-22H,5,9,11H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | RXOBZEGNJOADLO-WMZOPIPTSA-N |
| XLogP | 3.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |