C17H14O3 — CID 86091023
4-(3,4-dihydro-2H-furo[2,3-h]chromen-2-yl)phenol (PubChem CID 86091023) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-furo[2,3-h]chromen-2-yl)phenol.
| Compound Name | 4-(3,4-dihydro-2H-furo[2,3-h]chromen-2-yl)phenol |
|---|---|
| PubChem CID | 86091023 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-furo[2,3-h]chromen-2-yl)phenol |
| SMILES | Oc1ccc(C2CCc3ccc4occc4c3O2)cc1 |
| InChI | InChI=1S/C17H14O3/c18-13-5-1-11(2-6-13)15-7-3-12-4-8-16-14(9-10-19-16)17(12)20-15/h1-2,4-6,8-10,15,18H,3,7H2 |
| InChIKey | ORRBKWYKNTUWQC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |